About (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate
(3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate (PubChem CID 90002599) has the molecular formula C9H16O5S
and a molecular weight of 236.29 g/mol. Its IUPAC name is (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate |
| PubChem CID | 90002599 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate |
| SMILES | CC1C(OC(=O)C(C)(C)C)COS1(=O)=O |
| InChI | InChI=1S/C9H16O5S/c1-6-7(5-13-15(6,11)12)14-8(10)9(2,3)4/h6-7H,5H2,1-4H3 |
| InChIKey | DTNADEHWEULIMG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate?
The IUPAC name of (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate (CID 90002599) is (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate is CC1C(OC(=O)C(C)(C)C)COS1(=O)=O.
What is the InChIKey of (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate?
The InChIKey is DTNADEHWEULIMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5S/c1-6-7(5-13-15(6,11)12)14-8(10)9(2,3)4/h6-7H,5H2,1-4H3.
What are the key properties of (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate?
(3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate has a molecular weight of 236.29 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2,2-dioxooxathiolan-4-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 90002599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).