About (2,2-dioxooxathiolan-4-yl) diethyl phosphate
(2,2-dioxooxathiolan-4-yl) diethyl phosphate (PubChem CID 90002877) has the molecular formula C7H15O7PS
and a molecular weight of 274.23 g/mol. Its IUPAC name is (2,2-dioxooxathiolan-4-yl) diethyl phosphate.
Molecular Properties
| Compound Name | (2,2-dioxooxathiolan-4-yl) diethyl phosphate |
| PubChem CID | 90002877 |
| Molecular Formula | C7H15O7PS |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | (2,2-dioxooxathiolan-4-yl) diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC1COS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15O7PS/c1-3-11-15(8,12-4-2)14-7-5-13-16(9,10)6-7/h7H,3-6H2,1-2H3 |
| InChIKey | OXZSGRDTIKTVKK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dioxooxathiolan-4-yl) diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dioxooxathiolan-4-yl) diethyl phosphate?
The IUPAC name of (2,2-dioxooxathiolan-4-yl) diethyl phosphate (CID 90002877) is (2,2-dioxooxathiolan-4-yl) diethyl phosphate.
What is the SMILES notation for (2,2-dioxooxathiolan-4-yl) diethyl phosphate?
The canonical SMILES for (2,2-dioxooxathiolan-4-yl) diethyl phosphate is CCOP(=O)(OCC)OC1COS(=O)(=O)C1.
What is the InChIKey of (2,2-dioxooxathiolan-4-yl) diethyl phosphate?
The InChIKey is OXZSGRDTIKTVKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O7PS/c1-3-11-15(8,12-4-2)14-7-5-13-16(9,10)6-7/h7H,3-6H2,1-2H3.
What are the key properties of (2,2-dioxooxathiolan-4-yl) diethyl phosphate?
(2,2-dioxooxathiolan-4-yl) diethyl phosphate has a molecular weight of 274.23 g/mol, XLogP of 0.91, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dioxooxathiolan-4-yl) diethyl phosphate is sourced from PubChem (CID 90002877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).