About (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate
(5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate (PubChem CID 90002903) has the molecular formula C5H7FO6S
and a molecular weight of 214.17 g/mol. Its IUPAC name is (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate.
Molecular Properties
| Compound Name | (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate |
| PubChem CID | 90002903 |
| Molecular Formula | C5H7FO6S |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate |
| SMILES | COC(=O)OC1CS(=O)(=O)OC1F |
| InChI | InChI=1S/C5H7FO6S/c1-10-5(7)11-3-2-13(8,9)12-4(3)6/h3-4H,2H2,1H3 |
| InChIKey | ZZZUZDQNZMEWIO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate?
The IUPAC name of (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate (CID 90002903) is (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate.
What is the SMILES notation for (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate?
The canonical SMILES for (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate is COC(=O)OC1CS(=O)(=O)OC1F.
What is the InChIKey of (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate?
The InChIKey is ZZZUZDQNZMEWIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FO6S/c1-10-5(7)11-3-2-13(8,9)12-4(3)6/h3-4H,2H2,1H3.
What are the key properties of (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate?
(5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate has a molecular weight of 214.17 g/mol, XLogP of -0.21, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,2-dioxooxathiolan-4-yl) methyl carbonate is sourced from PubChem (CID 90002903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).