About (2,2-dioxooxathiolan-4-yl) dimethyl phosphate
(2,2-dioxooxathiolan-4-yl) dimethyl phosphate (PubChem CID 90002964) has the molecular formula C5H11O7PS
and a molecular weight of 246.18 g/mol. Its IUPAC name is (2,2-dioxooxathiolan-4-yl) dimethyl phosphate.
Molecular Properties
| Compound Name | (2,2-dioxooxathiolan-4-yl) dimethyl phosphate |
| PubChem CID | 90002964 |
| Molecular Formula | C5H11O7PS |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | (2,2-dioxooxathiolan-4-yl) dimethyl phosphate |
| SMILES | COP(=O)(OC)OC1COS(=O)(=O)C1 |
| InChI | InChI=1S/C5H11O7PS/c1-9-13(6,10-2)12-5-3-11-14(7,8)4-5/h5H,3-4H2,1-2H3 |
| InChIKey | KAGSGMXHMODTIF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dioxooxathiolan-4-yl) dimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dioxooxathiolan-4-yl) dimethyl phosphate?
The IUPAC name of (2,2-dioxooxathiolan-4-yl) dimethyl phosphate (CID 90002964) is (2,2-dioxooxathiolan-4-yl) dimethyl phosphate.
What is the SMILES notation for (2,2-dioxooxathiolan-4-yl) dimethyl phosphate?
The canonical SMILES for (2,2-dioxooxathiolan-4-yl) dimethyl phosphate is COP(=O)(OC)OC1COS(=O)(=O)C1.
What is the InChIKey of (2,2-dioxooxathiolan-4-yl) dimethyl phosphate?
The InChIKey is KAGSGMXHMODTIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O7PS/c1-9-13(6,10-2)12-5-3-11-14(7,8)4-5/h5H,3-4H2,1-2H3.
What are the key properties of (2,2-dioxooxathiolan-4-yl) dimethyl phosphate?
(2,2-dioxooxathiolan-4-yl) dimethyl phosphate has a molecular weight of 246.18 g/mol, XLogP of 0.13, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dioxooxathiolan-4-yl) dimethyl phosphate is sourced from PubChem (CID 90002964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).