C16H20N2O — CID 90003117
14,15-diazatetracyclo[9.7.0.02,7.012,17]octadeca-3,5,7,9-tetraen-5-ol (PubChem CID 90003117) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 14,15-diazatetracyclo[9.7.0.02,7.012,17]octadeca-3,5,7,9-tetraen-5-ol.
| Compound Name | 14,15-diazatetracyclo[9.7.0.02,7.012,17]octadeca-3,5,7,9-tetraen-5-ol |
|---|---|
| PubChem CID | 90003117 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 14,15-diazatetracyclo[9.7.0.02,7.012,17]octadeca-3,5,7,9-tetraen-5-ol |
| SMILES | OC1=CC2=CC=CC3C4CNNCC4CC3C2C=C1 |
| InChI | InChI=1S/C16H20N2O/c19-12-4-5-13-10(6-12)2-1-3-14-15(13)7-11-8-17-18-9-16(11)14/h1-6,11,13-19H,7-9H2 |
| InChIKey | GDXFYISRMSERQC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |