About 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile
3,6-diiminocyclohexa-1,4-diene-1-carbonitrile (PubChem CID 90003161) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile |
| PubChem CID | 90003161 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile |
| SMILES | [H]/N=C1\C=C/C(=N\[H])C(C#N)=C1 |
| InChI | InChI=1S/C7H5N3/c8-4-5-3-6(9)1-2-7(5)10/h1-3,9-10H/b9-6+,10-7+ |
| InChIKey | BGMZRDVRGWTSOI-KZZDLZNXSA-N |
| XLogP | 1.05 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile?
The IUPAC name of 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile (CID 90003161) is 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile.
What is the SMILES notation for 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile?
The canonical SMILES for 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile is [H]/N=C1\C=C/C(=N\[H])C(C#N)=C1.
What is the InChIKey of 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile?
The InChIKey is BGMZRDVRGWTSOI-KZZDLZNXSA-N. The full InChI is InChI=1S/C7H5N3/c8-4-5-3-6(9)1-2-7(5)10/h1-3,9-10H/b9-6+,10-7+.
What are the key properties of 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile?
3,6-diiminocyclohexa-1,4-diene-1-carbonitrile has a molecular weight of 131.14 g/mol, XLogP of 1.05, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diiminocyclohexa-1,4-diene-1-carbonitrile is sourced from PubChem (CID 90003161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).