C36H46N4O4 — CID 90003211
11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(pyridazin-4-ylmethyl)-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 90003211) has the molecular formula C36H46N4O4 and a molecular weight of 598.79 g/mol. Its IUPAC name is 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(pyridazin-4-ylmethyl)-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(pyridazin-4-ylmethyl)-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 90003211 |
| Molecular Formula | C36H46N4O4 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(pyridazin-4-ylmethyl)-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | CC1(C(=O)NCc2ccnnc2)CCC2(C)CCC3(C)C4(C)CCC5C(C)(C)C(=O)C(C#N)=CC5(C)C4=CC(=O)C3(O)C2C1 |
| InChI | InChI=1S/C36H46N4O4/c1-30(2)24-8-10-34(6)25(33(24,5)17-23(19-37)28(30)42)16-27(41)36(44)26-18-32(4,12-11-31(26,3)13-14-35(34,36)7)29(43)38-20-22-9-15-39-40-21-22/h9,15-17,21,24,26,44H,8,10-14,18,20H2,1-7H3,(H,38,43) |
| InChIKey | RGHUBAOGQXWWKI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |