C23H26FN7O2 — CID 90003493
(6S)-13-(ethylamino)-8-[3-(2-fluoroethyl)-2-methyl-4-oxoquinazolin-8-yl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 90003493) has the molecular formula C23H26FN7O2 and a molecular weight of 451.51 g/mol. Its IUPAC name is (6S)-13-(ethylamino)-8-[3-(2-fluoroethyl)-2-methyl-4-oxoquinazolin-8-yl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-13-(ethylamino)-8-[3-(2-fluoroethyl)-2-methyl-4-oxoquinazolin-8-yl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 90003493 |
| Molecular Formula | C23H26FN7O2 |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (6S)-13-(ethylamino)-8-[3-(2-fluoroethyl)-2-methyl-4-oxoquinazolin-8-yl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc3c(=O)n(CCF)c(C)nc13)C2=O |
| InChI | InChI=1S/C23H26FN7O2/c1-3-25-23-26-12-17-20(28-23)30-10-5-6-15(30)13-31(22(17)33)18-8-4-7-16-19(18)27-14(2)29(11-9-24)21(16)32/h4,7-8,12,15H,3,5-6,9-11,13H2,1-2H3,(H,25,26,28)/t15-/m0/s1 |
| InChIKey | LFUSTISWWTWSNO-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |