About (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate
(3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate (PubChem CID 90003585) has the molecular formula C12H14O6S
and a molecular weight of 286.31 g/mol. Its IUPAC name is (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate.
Molecular Properties
| Compound Name | (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate |
| PubChem CID | 90003585 |
| Molecular Formula | C12H14O6S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate |
| SMILES | Cc1ccc(OC(=O)OC2COS(=O)(=O)C2)cc1C |
| InChI | InChI=1S/C12H14O6S/c1-8-3-4-10(5-9(8)2)17-12(13)18-11-6-16-19(14,15)7-11/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | KYRFWUOUPPNARM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate?
The IUPAC name of (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate (CID 90003585) is (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate.
What is the SMILES notation for (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate?
The canonical SMILES for (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate is Cc1ccc(OC(=O)OC2COS(=O)(=O)C2)cc1C.
What is the InChIKey of (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate?
The InChIKey is KYRFWUOUPPNARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O6S/c1-8-3-4-10(5-9(8)2)17-12(13)18-11-6-16-19(14,15)7-11/h3-5,11H,6-7H2,1-2H3.
What are the key properties of (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate?
(3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate has a molecular weight of 286.31 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl) (2,2-dioxooxathiolan-4-yl) carbonate is sourced from PubChem (CID 90003585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).