C16H18N2 — CID 90003823
14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1,11,13,15,17-pentaene (PubChem CID 90003823) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1,11,13,15,17-pentaene.
| Compound Name | 14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1,11,13,15,17-pentaene |
|---|---|
| PubChem CID | 90003823 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1,11,13,15,17-pentaene |
| SMILES | C1=NN=c2cc3c(cc21)=C1CCCCC1CCC3 |
| InChI | InChI=1S/C16H18N2/c1-2-7-14-11(4-1)5-3-6-12-9-16-13(8-15(12)14)10-17-18-16/h8-11H,1-7H2 |
| InChIKey | JDUNJORQGSXRNB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |