C25H27F4N3O3S — CID 90003844
[16-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),11,13(17),15-tetraen-5-yl] sulfamate (PubChem CID 90003844) has the molecular formula C25H27F4N3O3S and a molecular weight of 525.57 g/mol. Its IUPAC name is [16-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),11,13(17),15-tetraen-5-yl] sulfamate.
| Compound Name | [16-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),11,13(17),15-tetraen-5-yl] sulfamate |
|---|---|
| PubChem CID | 90003844 |
| Molecular Formula | C25H27F4N3O3S |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | [16-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),11,13(17),15-tetraen-5-yl] sulfamate |
| SMILES | CCc1nn(-c2ccc(F)cc2)c2cc3c(cc12)C1CCC(OS(N)(=O)=O)(C(F)(F)F)CC1CCC3 |
| InChI | InChI=1S/C25H27F4N3O3S/c1-2-22-21-13-20-15(12-23(21)32(31-22)18-8-6-17(26)7-9-18)4-3-5-16-14-24(25(27,28)29,11-10-19(16)20)35-36(30,33)34/h6-9,12-13,16,19H,2-5,10-11,14H2,1H3,(H2,30,33,34) |
| InChIKey | LOXVVQMSMCZTIZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |