C10H7F3O5S — CID 90004070
(2,2-dioxooxathiolan-4-yl) 2,4,6-trifluorobenzoate (PubChem CID 90004070) has the molecular formula C10H7F3O5S and a molecular weight of 296.22 g/mol. Its IUPAC name is (2,2-dioxooxathiolan-4-yl) 2,4,6-trifluorobenzoate.
| Compound Name | (2,2-dioxooxathiolan-4-yl) 2,4,6-trifluorobenzoate |
|---|---|
| PubChem CID | 90004070 |
| Molecular Formula | C10H7F3O5S |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | (2,2-dioxooxathiolan-4-yl) 2,4,6-trifluorobenzoate |
| SMILES | O=C(OC1COS(=O)(=O)C1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H7F3O5S/c11-5-1-7(12)9(8(13)2-5)10(14)18-6-3-17-19(15,16)4-6/h1-2,6H,3-4H2 |
| InChIKey | WESUDOILLJRSIF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|