C18H18N4O2 — CID 90004082
2-[(2,4-dimethyl-3-pyridinyl)oxy]-N-[(E)-1H-indol-4-ylmethylideneamino]acetamide (PubChem CID 90004082) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-3-pyridinyl)oxy]-N-[(E)-1H-indol-4-ylmethylideneamino]acetamide.
| Compound Name | 2-[(2,4-dimethyl-3-pyridinyl)oxy]-N-[(E)-1H-indol-4-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 90004082 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[(2,4-dimethyl-3-pyridinyl)oxy]-N-[(E)-1H-indol-4-ylmethylideneamino]acetamide |
| SMILES | Cc1ccnc(C)c1OCC(=O)N/N=C/c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C18H18N4O2/c1-12-6-8-19-13(2)18(12)24-11-17(23)22-21-10-14-4-3-5-16-15(14)7-9-20-16/h3-10,20H,11H2,1-2H3,(H,22,23)/b21-10+ |
| InChIKey | OOCCZJVDXZBPKI-UFFVCSGVSA-N |
| XLogP | 2.71 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|