About ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate
ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 90004269) has the molecular formula C21H41NO6Si
and a molecular weight of 431.65 g/mol. Its IUPAC name is ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 90004269 |
| Molecular Formula | C21H41NO6Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C(C)(C)C)CC1(CO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H41NO6Si/c1-18(2,3)26-16(24)21(14-23)12-15(28-29(10,11)20(7,8)9)13-22(21)17(25)27-19(4,5)6/h15,23H,12-14H2,1-11H3 |
| InChIKey | JCEKKAXBPMPTJF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate?
The IUPAC name of ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate (CID 90004269) is ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C(C)(C)C)CC1(CO)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate?
The InChIKey is JCEKKAXBPMPTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41NO6Si/c1-18(2,3)26-16(24)21(14-23)12-15(28-29(10,11)20(7,8)9)13-22(21)17(25)27-19(4,5)6/h15,23H,12-14H2,1-11H3.
What are the key properties of ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate?
ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate has a molecular weight of 431.65 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 90004269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).