C23H24F3N7O2 — CID 90004372
(6S)-13-(ethylamino)-8-[3-ethyl-4-oxo-2-(trifluoromethyl)quinazolin-8-yl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 90004372) has the molecular formula C23H24F3N7O2 and a molecular weight of 487.49 g/mol. Its IUPAC name is (6S)-13-(ethylamino)-8-[3-ethyl-4-oxo-2-(trifluoromethyl)quinazolin-8-yl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-13-(ethylamino)-8-[3-ethyl-4-oxo-2-(trifluoromethyl)quinazolin-8-yl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 90004372 |
| Molecular Formula | C23H24F3N7O2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | (6S)-13-(ethylamino)-8-[3-ethyl-4-oxo-2-(trifluoromethyl)quinazolin-8-yl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc3c(=O)n(CC)c(C(F)(F)F)nc13)C2=O |
| InChI | InChI=1S/C23H24F3N7O2/c1-3-27-22-28-11-15-18(30-22)32-10-6-7-13(32)12-33(20(15)35)16-9-5-8-14-17(16)29-21(23(24,25)26)31(4-2)19(14)34/h5,8-9,11,13H,3-4,6-7,10,12H2,1-2H3,(H,27,28,30)/t13-/m0/s1 |
| InChIKey | AUIDIOWARSEGIG-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |