C22H24N6O2 — CID 90004377
(6S)-8-(2-ethyl-1-oxoisoquinolin-5-yl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 90004377) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (6S)-8-(2-ethyl-1-oxoisoquinolin-5-yl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-8-(2-ethyl-1-oxoisoquinolin-5-yl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 90004377 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (6S)-8-(2-ethyl-1-oxoisoquinolin-5-yl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCn1ccc2c(N3C[C@@H]4CCCN4c4nc(NC)ncc4C3=O)cccc2c1=O |
| InChI | InChI=1S/C22H24N6O2/c1-3-26-11-9-15-16(20(26)29)7-4-8-18(15)28-13-14-6-5-10-27(14)19-17(21(28)30)12-24-22(23-2)25-19/h4,7-9,11-12,14H,3,5-6,10,13H2,1-2H3,(H,23,24,25)/t14-/m0/s1 |
| InChIKey | SJVKBMAGLINNFM-AWEZNQCLSA-N |
| XLogP | 2.48 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |