C34H35AsFN7O3 — CID 90004642
CID 90004642 (PubChem CID 90004642) has the molecular formula C34H35AsFN7O3 and a molecular weight of 683.62 g/mol.
| Compound Name | CID 90004642 |
|---|---|
| PubChem CID | 90004642 |
| Molecular Formula | C34H35AsFN7O3 |
| Molecular Weight | 683.62 g/mol |
| Exact Mass | 683.20 |
| IUPAC Name | — |
| SMILES | CCN(C1COC1)C(C)(C)/C=C(/C#N)C(=O)N1CCC[C@@H]1Cn1nc(-c2ccc(Oc3ccccc3)cc2F)c2c([As])ncnc21 |
| InChI | InChI=1S/C34H35AsFN7O3/c1-4-42(24-19-45-20-24)34(2,3)16-22(17-37)33(44)41-14-8-9-23(41)18-43-32-29(31(35)38-21-39-32)30(40-43)27-13-12-26(15-28(27)36)46-25-10-6-5-7-11-25/h5-7,10-13,15-16,21,23-24H,4,8-9,14,18-20H2,1-3H3/b22-16-/t23-/m1/s1 |
| InChIKey | CUQLIDSZAIXUMN-YTMAHBJJSA-N |
| XLogP | 4.16 |
| TPSA | 109.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|