C18H34O5Si — CID 90004663
(2Z,4E,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)deca-2,4-dienoic acid (PubChem CID 90004663) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (2Z,4E,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)deca-2,4-dienoic acid.
| Compound Name | (2Z,4E,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)deca-2,4-dienoic acid |
|---|---|
| PubChem CID | 90004663 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (2Z,4E,6R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)deca-2,4-dienoic acid |
| SMILES | COCO[C@@H](/C=C/C=C\C(=O)O)CC[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O5Si/c1-15(23-24(6,7)18(2,3)4)12-13-16(22-14-21-5)10-8-9-11-17(19)20/h8-11,15-16H,12-14H2,1-7H3,(H,19,20)/b10-8+,11-9-/t15-,16+/m1/s1 |
| InChIKey | UUEUEOBYLMTLOJ-RWEUXVQWSA-N |
| XLogP | 4.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|