C21H24N3OS2+ — CID 9000498
N-(4-methylphenyl)-2-[4-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 9000498) has the molecular formula C21H24N3OS2+ and a molecular weight of 398.58 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[4-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[4-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9000498 |
| Molecular Formula | C21H24N3OS2+ |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(4-methylphenyl)-2-[4-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2nc(C[NH+]3CCc4sccc4[C@H]3C)cs2)cc1 |
| InChI | InChI=1S/C21H23N3OS2/c1-14-3-5-16(6-4-14)22-20(25)11-21-23-17(13-27-21)12-24-9-7-19-18(15(24)2)8-10-26-19/h3-6,8,10,13,15H,7,9,11-12H2,1-2H3,(H,22,25)/p+1/t15-/m1/s1 |
| InChIKey | IFNOAQVNZHHNGF-OAHLLOKOSA-O |
| XLogP | 3.40 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |