About methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate
methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate (PubChem CID 90005211) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate |
| PubChem CID | 90005211 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate |
| SMILES | C=C/C=C\C=C1\C=C(C(=O)OC)C=NC1 |
| InChI | InChI=1S/C12H13NO2/c1-3-4-5-6-10-7-11(9-13-8-10)12(14)15-2/h3-7,9H,1,8H2,2H3/b5-4-,10-6- |
| InChIKey | ZJKWGILDDVEQRF-ARSRRCBKSA-N |
| XLogP | 1.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate?
The IUPAC name of methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate (CID 90005211) is methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate.
What is the SMILES notation for methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate?
The canonical SMILES for methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate is C=C/C=C\C=C1\C=C(C(=O)OC)C=NC1.
What is the InChIKey of methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate?
The InChIKey is ZJKWGILDDVEQRF-ARSRRCBKSA-N. The full InChI is InChI=1S/C12H13NO2/c1-3-4-5-6-10-7-11(9-13-8-10)12(14)15-2/h3-7,9H,1,8H2,2H3/b5-4-,10-6-.
What are the key properties of methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate?
methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate has a molecular weight of 203.24 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3Z)-3-[(2Z)-penta-2,4-dienylidene]-2H-pyridine-5-carboxylate is sourced from PubChem (CID 90005211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).