C22H10Cl4S2 — CID 90005331
3,9,12,19-tetrachloro-5,7-dimethyl-15,16-dithiahexacyclo[12.5.2.12,6.011,20.017,21.010,22]docosa-1(19),2,4,6(22),7,9,11,13,17,20-decaene (PubChem CID 90005331) has the molecular formula C22H10Cl4S2 and a molecular weight of 480.27 g/mol. Its IUPAC name is 3,9,12,19-tetrachloro-5,7-dimethyl-15,16-dithiahexacyclo[12.5.2.12,6.011,20.017,21.010,22]docosa-1(19),2,4,6(22),7,9,11,13,17,20-decaene.
| Compound Name | 3,9,12,19-tetrachloro-5,7-dimethyl-15,16-dithiahexacyclo[12.5.2.12,6.011,20.017,21.010,22]docosa-1(19),2,4,6(22),7,9,11,13,17,20-decaene |
|---|---|
| PubChem CID | 90005331 |
| Molecular Formula | C22H10Cl4S2 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 477.90 |
| IUPAC Name | 3,9,12,19-tetrachloro-5,7-dimethyl-15,16-dithiahexacyclo[12.5.2.12,6.011,20.017,21.010,22]docosa-1(19),2,4,6(22),7,9,11,13,17,20-decaene |
| SMILES | Cc1cc(Cl)c2c3c(Cl)cc4c5c(cc(Cl)c(c6c(Cl)cc(C)c1c26)c53)SS4 |
| InChI | InChI=1S/C22H10Cl4S2/c1-7-3-9(23)16-18-11(25)5-13-20-14(28-27-13)6-12(26)19(22(18)20)17-10(24)4-8(2)15(7)21(16)17/h3-6H,1-2H3 |
| InChIKey | HVPKDMQOVLSDAJ-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|