C41H52N8O6S — CID 90005543
6-[4-[6-[[2-[(1-benzylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetyl]amino]-4-methylquinolin-2-yl]piperazin-1-yl]-N-methylhexanamide (PubChem CID 90005543) has the molecular formula C41H52N8O6S and a molecular weight of 784.98 g/mol. Its IUPAC name is 6-[4-[6-[[2-[(1-benzylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetyl]amino]-4-methylquinolin-2-yl]piperazin-1-yl]-N-methylhexanamide.
| Compound Name | 6-[4-[6-[[2-[(1-benzylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetyl]amino]-4-methylquinolin-2-yl]piperazin-1-yl]-N-methylhexanamide |
|---|---|
| PubChem CID | 90005543 |
| Molecular Formula | C41H52N8O6S |
| Molecular Weight | 784.98 g/mol |
| Exact Mass | 784.37 |
| IUPAC Name | 6-[4-[6-[[2-[(1-benzylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetyl]amino]-4-methylquinolin-2-yl]piperazin-1-yl]-N-methylhexanamide |
| SMILES | CNC(=O)CCCCCN1CCN(c2cc(C)c3cc(NC(=O)CN(C4CCN(Cc5ccccc5)CC4)S(=O)(=O)c4ccccc4[N+](=O)[O-])ccc3n2)CC1 |
| InChI | InChI=1S/C41H52N8O6S/c1-31-27-39(47-25-23-45(24-26-47)20-10-4-7-15-40(50)42-2)44-36-17-16-33(28-35(31)36)43-41(51)30-48(56(54,55)38-14-9-8-13-37(38)49(52)53)34-18-21-46(22-19-34)29-32-11-5-3-6-12-32/h3,5-6,8-9,11-14,16-17,27-28,34H,4,7,10,15,18-26,29-30H2,1-2H3,(H,42,50)(H,43,51) |
| InChIKey | MMYYOJGYFANGLZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 161.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.98 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|