C44H26O8 — CID 90005588
4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid (PubChem CID 90005588) has the molecular formula C44H26O8 and a molecular weight of 682.68 g/mol. Its IUPAC name is 4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid.
| Compound Name | 4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid |
|---|---|
| PubChem CID | 90005588 |
| Molecular Formula | C44H26O8 |
| Molecular Weight | 682.68 g/mol |
| Exact Mass | 682.16 |
| IUPAC Name | 4-[3,6,8-tris(4-carboxyphenyl)pyren-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)c3ccc4c(-c5ccc(C(=O)O)cc5)cc(-c5ccc(C(=O)O)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C44H26O8/c45-41(46)27-9-1-23(2-10-27)35-21-36(24-3-11-28(12-4-24)42(47)48)32-19-20-34-38(26-7-15-30(16-8-26)44(51)52)22-37(25-5-13-29(14-6-25)43(49)50)33-18-17-31(35)39(32)40(33)34/h1-22H,(H,45,46)(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | HVCDAMXLLUJLQZ-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.68 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|