About ethane;N,N,2-trichloroaniline
ethane;N,N,2-trichloroaniline (PubChem CID 90006156) has the molecular formula C8H10Cl3N
and a molecular weight of 226.53 g/mol. Its IUPAC name is ethane;N,N,2-trichloroaniline.
Molecular Properties
| Compound Name | ethane;N,N,2-trichloroaniline |
| PubChem CID | 90006156 |
| Molecular Formula | C8H10Cl3N |
| Molecular Weight | 226.53 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | ethane;N,N,2-trichloroaniline |
| SMILES | CC.Clc1ccccc1N(Cl)Cl |
| InChI | InChI=1S/C6H4Cl3N.C2H6/c7-5-3-1-2-4-6(5)10(8)9;1-2/h1-4H;1-2H3 |
| InChIKey | VRFMBTDQEJAYCM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;N,N,2-trichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N,N,2-trichloroaniline?
The IUPAC name of ethane;N,N,2-trichloroaniline (CID 90006156) is ethane;N,N,2-trichloroaniline.
What is the SMILES notation for ethane;N,N,2-trichloroaniline?
The canonical SMILES for ethane;N,N,2-trichloroaniline is CC.Clc1ccccc1N(Cl)Cl.
What is the InChIKey of ethane;N,N,2-trichloroaniline?
The InChIKey is VRFMBTDQEJAYCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl3N.C2H6/c7-5-3-1-2-4-6(5)10(8)9;1-2/h1-4H;1-2H3.
What are the key properties of ethane;N,N,2-trichloroaniline?
ethane;N,N,2-trichloroaniline has a molecular weight of 226.53 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N,N,2-trichloroaniline is sourced from PubChem (CID 90006156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).