C17H22F3N3O2 — CID 90006256
4-cyclobutyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene;2,2,2-trifluoroacetic acid (PubChem CID 90006256) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 4-cyclobutyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene;2,2,2-trifluoroacetic acid.
| Compound Name | 4-cyclobutyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90006256 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-cyclobutyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cc2c3c(c1)N(C1CCC1)CCN3CCNC2 |
| InChI | InChI=1S/C15H21N3.C2HF3O2/c1-3-12-11-16-7-8-17-9-10-18(13-4-2-5-13)14(6-1)15(12)17;3-2(4,5)1(6)7/h1,3,6,13,16H,2,4-5,7-11H2;(H,6,7) |
| InChIKey | AWDLQZLPLCDPBK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |