About 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline
4-chloro-6,8-dimethyl-5,6-dihydroquinazoline (PubChem CID 90006271) has the molecular formula C10H11ClN2
and a molecular weight of 194.66 g/mol. Its IUPAC name is 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline.
Molecular Properties
| Compound Name | 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline |
| PubChem CID | 90006271 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline |
| SMILES | CC1=CC(C)Cc2c(Cl)ncnc21 |
| InChI | InChI=1S/C10H11ClN2/c1-6-3-7(2)9-8(4-6)10(11)13-5-12-9/h3,5-6H,4H2,1-2H3 |
| InChIKey | NZKQVASTEVHCBE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline?
The IUPAC name of 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline (CID 90006271) is 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline.
What is the SMILES notation for 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline?
The canonical SMILES for 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline is CC1=CC(C)Cc2c(Cl)ncnc21.
What is the InChIKey of 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline?
The InChIKey is NZKQVASTEVHCBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2/c1-6-3-7(2)9-8(4-6)10(11)13-5-12-9/h3,5-6H,4H2,1-2H3.
What are the key properties of 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline?
4-chloro-6,8-dimethyl-5,6-dihydroquinazoline has a molecular weight of 194.66 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,8-dimethyl-5,6-dihydroquinazoline is sourced from PubChem (CID 90006271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).