About (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene
(3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene (PubChem CID 90007355) has the molecular formula C21H39N3
and a molecular weight of 333.56 g/mol. Its IUPAC name is (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene.
Molecular Properties
| Compound Name | (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene |
| PubChem CID | 90007355 |
| Molecular Formula | C21H39N3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.31 |
| IUPAC Name | (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene |
| SMILES | C1=C(C2=N\NNCCCCCCCC/2)\CCCCCCCCCC/1 |
| InChI | InChI=1S/C21H39N3/c1-2-4-8-12-16-20(17-13-9-5-3-1)21-18-14-10-6-7-11-15-19-22-24-23-21/h16,22,24H,1-15,17-19H2/b20-16+,23-21- |
| InChIKey | QEQPMEHPLFYJPD-MVINRXBHSA-N |
| XLogP | 6.02 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene?
The IUPAC name of (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene (CID 90007355) is (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene.
What is the SMILES notation for (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene?
The canonical SMILES for (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene is C1=C(C2=N\NNCCCCCCCC/2)\CCCCCCCCCC/1.
What is the InChIKey of (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene?
The InChIKey is QEQPMEHPLFYJPD-MVINRXBHSA-N. The full InChI is InChI=1S/C21H39N3/c1-2-4-8-12-16-20(17-13-9-5-3-1)21-18-14-10-6-7-11-15-19-22-24-23-21/h16,22,24H,1-15,17-19H2/b20-16+,23-21-.
What are the key properties of (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene?
(3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene has a molecular weight of 333.56 g/mol, XLogP of 6.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-[(1E)-cyclododecen-1-yl]-1,2,3-triazacyclododec-3-ene is sourced from PubChem (CID 90007355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).