C36H36F6N4O5 — CID 90007356
N-[3-[[4-[1-[4-(2,3-dimethylphenoxy)butanoyl]-3,4-dihydro-2H-quinolin-5-yl]pyrazol-1-yl]methyl]phenyl]-4,4,4-trifluoro-2,3-dihydroxy-3-(trifluoromethyl)butanamide (PubChem CID 90007356) has the molecular formula C36H36F6N4O5 and a molecular weight of 718.70 g/mol. Its IUPAC name is N-[3-[[4-[1-[4-(2,3-dimethylphenoxy)butanoyl]-3,4-dihydro-2H-quinolin-5-yl]pyrazol-1-yl]methyl]phenyl]-4,4,4-trifluoro-2,3-dihydroxy-3-(trifluoromethyl)butanamide.
| Compound Name | N-[3-[[4-[1-[4-(2,3-dimethylphenoxy)butanoyl]-3,4-dihydro-2H-quinolin-5-yl]pyrazol-1-yl]methyl]phenyl]-4,4,4-trifluoro-2,3-dihydroxy-3-(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 90007356 |
| Molecular Formula | C36H36F6N4O5 |
| Molecular Weight | 718.70 g/mol |
| Exact Mass | 718.26 |
| IUPAC Name | N-[3-[[4-[1-[4-(2,3-dimethylphenoxy)butanoyl]-3,4-dihydro-2H-quinolin-5-yl]pyrazol-1-yl]methyl]phenyl]-4,4,4-trifluoro-2,3-dihydroxy-3-(trifluoromethyl)butanamide |
| SMILES | Cc1cccc(OCCCC(=O)N2CCCc3c(-c4cnn(Cc5cccc(NC(=O)C(O)C(O)(C(F)(F)F)C(F)(F)F)c5)c4)cccc32)c1C |
| InChI | InChI=1S/C36H36F6N4O5/c1-22-8-3-14-30(23(22)2)51-17-7-15-31(47)46-16-6-12-28-27(11-5-13-29(28)46)25-19-43-45(21-25)20-24-9-4-10-26(18-24)44-33(49)32(48)34(50,35(37,38)39)36(40,41)42/h3-5,8-11,13-14,18-19,21,32,48,50H,6-7,12,15-17,20H2,1-2H3,(H,44,49) |
| InChIKey | RWIBTWYXLOTRMZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.70 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|