C15H21ClN4O3 — CID 90008150
(2S,3S,4R,5R)-1-tert-butyl-2-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 90008150) has the molecular formula C15H21ClN4O3 and a molecular weight of 340.81 g/mol. Its IUPAC name is (2S,3S,4R,5R)-1-tert-butyl-2-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-1-tert-butyl-2-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 90008150 |
| Molecular Formula | C15H21ClN4O3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2S,3S,4R,5R)-1-tert-butyl-2-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | CC(C)(C)N1[C@H](CO)[C@@H](O)[C@@H](O)[C@@H]1c1c[nH]c2c(Cl)ncnc12 |
| InChI | InChI=1S/C15H21ClN4O3/c1-15(2,3)20-8(5-21)12(22)13(23)11(20)7-4-17-10-9(7)18-6-19-14(10)16/h4,6,8,11-13,17,21-23H,5H2,1-3H3/t8-,11+,12-,13+/m1/s1 |
| InChIKey | WPIDOXUROZNRBK-NZBQSGDWSA-N |
| XLogP | 0.85 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |