C34H32N6O — CID 90008197
4-[4-[4-[3-(6-cyclopropyl-1H-phthalazin-2-yl)-2-methylphenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]morpholine (PubChem CID 90008197) has the molecular formula C34H32N6O and a molecular weight of 540.67 g/mol. Its IUPAC name is 4-[4-[4-[3-(6-cyclopropyl-1H-phthalazin-2-yl)-2-methylphenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]morpholine.
| Compound Name | 4-[4-[4-[3-(6-cyclopropyl-1H-phthalazin-2-yl)-2-methylphenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 90008197 |
| Molecular Formula | C34H32N6O |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 4-[4-[4-[3-(6-cyclopropyl-1H-phthalazin-2-yl)-2-methylphenyl]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]morpholine |
| SMILES | Cc1c(-c2ncnc3[nH]c(-c4ccc(N5CCOCC5)cc4)cc23)cccc1N1Cc2ccc(C3CC3)cc2C=N1 |
| InChI | InChI=1S/C34H32N6O/c1-22-29(3-2-4-32(22)40-20-26-8-7-25(23-5-6-23)17-27(26)19-37-40)33-30-18-31(38-34(30)36-21-35-33)24-9-11-28(12-10-24)39-13-15-41-16-14-39/h2-4,7-12,17-19,21,23H,5-6,13-16,20H2,1H3,(H,35,36,38) |
| InChIKey | YHXYZLYWFMLPQM-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|