C17H18BN2O3+ — CID 90008811
2-(1,3,2-dioxaborolan-2-yl)-1-phenyl-1,3-dihydroisoindol-2-ium-2-carboxamide (PubChem CID 90008811) has the molecular formula C17H18BN2O3+ and a molecular weight of 309.15 g/mol. Its IUPAC name is 2-(1,3,2-dioxaborolan-2-yl)-1-phenyl-1,3-dihydroisoindol-2-ium-2-carboxamide.
| Compound Name | 2-(1,3,2-dioxaborolan-2-yl)-1-phenyl-1,3-dihydroisoindol-2-ium-2-carboxamide |
|---|---|
| PubChem CID | 90008811 |
| Molecular Formula | C17H18BN2O3+ |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(1,3,2-dioxaborolan-2-yl)-1-phenyl-1,3-dihydroisoindol-2-ium-2-carboxamide |
| SMILES | NC(=O)[N+]1(B2OCCO2)Cc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C17H17BN2O3/c19-17(21)20(18-22-10-11-23-18)12-14-8-4-5-9-15(14)16(20)13-6-2-1-3-7-13/h1-9,16H,10-12H2,(H-,19,21)/p+1 |
| InChIKey | FBWPFLNNCOLFOV-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|