C26H41NO2 — CID 90008891
(4Z,7Z,10Z,13Z,16Z,19Z)-N-(4-hydroxybutyl)docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 90008891) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-(4-hydroxybutyl)docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-(4-hydroxybutyl)docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 90008891 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-(4-hydroxybutyl)docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCCCO |
| InChI | InChI=1S/C26H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-26(29)27-24-21-22-25-28/h3-4,6-7,9-10,12-13,15-16,18-19,28H,2,5,8,11,14,17,20-25H2,1H3,(H,27,29)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | USOHASFSJWTGPW-KUBAVDMBSA-N |
| XLogP | 6.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|