About (3-amino-4-fluorophenyl) ethaneperoxoate
(3-amino-4-fluorophenyl) ethaneperoxoate (PubChem CID 90010453) has the molecular formula C8H8FNO3
and a molecular weight of 185.15 g/mol. Its IUPAC name is (3-amino-4-fluorophenyl) ethaneperoxoate.
Molecular Properties
| Compound Name | (3-amino-4-fluorophenyl) ethaneperoxoate |
| PubChem CID | 90010453 |
| Molecular Formula | C8H8FNO3 |
| Molecular Weight | 185.15 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | (3-amino-4-fluorophenyl) ethaneperoxoate |
| SMILES | CC(=O)OOc1ccc(F)c(N)c1 |
| InChI | InChI=1S/C8H8FNO3/c1-5(11)12-13-6-2-3-7(9)8(10)4-6/h2-4H,10H2,1H3 |
| InChIKey | WUVIQTUEKOWQEC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-4-fluorophenyl) ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-4-fluorophenyl) ethaneperoxoate?
The IUPAC name of (3-amino-4-fluorophenyl) ethaneperoxoate (CID 90010453) is (3-amino-4-fluorophenyl) ethaneperoxoate.
What is the SMILES notation for (3-amino-4-fluorophenyl) ethaneperoxoate?
The canonical SMILES for (3-amino-4-fluorophenyl) ethaneperoxoate is CC(=O)OOc1ccc(F)c(N)c1.
What is the InChIKey of (3-amino-4-fluorophenyl) ethaneperoxoate?
The InChIKey is WUVIQTUEKOWQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNO3/c1-5(11)12-13-6-2-3-7(9)8(10)4-6/h2-4H,10H2,1H3.
What are the key properties of (3-amino-4-fluorophenyl) ethaneperoxoate?
(3-amino-4-fluorophenyl) ethaneperoxoate has a molecular weight of 185.15 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-4-fluorophenyl) ethaneperoxoate is sourced from PubChem (CID 90010453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).