C11H17ClINO2 — CID 90010871
1-(4-iodophenyl)-N,N-dimethoxypropan-2-amine;hydrochloride (PubChem CID 90010871) has the molecular formula C11H17ClINO2 and a molecular weight of 357.62 g/mol. Its IUPAC name is 1-(4-iodophenyl)-N,N-dimethoxypropan-2-amine;hydrochloride.
| Compound Name | 1-(4-iodophenyl)-N,N-dimethoxypropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90010871 |
| Molecular Formula | C11H17ClINO2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1-(4-iodophenyl)-N,N-dimethoxypropan-2-amine;hydrochloride |
| SMILES | CON(OC)C(C)Cc1ccc(I)cc1.Cl |
| InChI | InChI=1S/C11H16INO2.ClH/c1-9(13(14-2)15-3)8-10-4-6-11(12)7-5-10;/h4-7,9H,8H2,1-3H3;1H |
| InChIKey | DVELCDROTQTMHL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|