C23H19F6NO3 — CID 90011015
1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-6-[(E)-3-oxobut-1-enyl]-3,4-dihydroquinolin-2-one (PubChem CID 90011015) has the molecular formula C23H19F6NO3 and a molecular weight of 471.40 g/mol. Its IUPAC name is 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-6-[(E)-3-oxobut-1-enyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-6-[(E)-3-oxobut-1-enyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 90011015 |
| Molecular Formula | C23H19F6NO3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-6-[(E)-3-oxobut-1-enyl]-3,4-dihydroquinolin-2-one |
| SMILES | CC(=O)/C=C/c1ccc2c(c1)CCC(=O)N2Cc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H19F6NO3/c1-14(31)2-3-15-6-10-19-17(12-15)7-11-20(32)30(19)13-16-4-8-18(9-5-16)21(33,22(24,25)26)23(27,28)29/h2-6,8-10,12,33H,7,11,13H2,1H3/b3-2+ |
| InChIKey | WZDOPOKBASUIBN-NSCUHMNNSA-N |
| XLogP | 5.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|