C15H21NO3 — CID 90011056
(3S,3aR,5R)-3-methyl-5-(phenylmethoxymethyl)-3,3a,4,5,7,7a-hexahydro-1H-pyrano[3,4-c][1,2]oxazole (PubChem CID 90011056) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (3S,3aR,5R)-3-methyl-5-(phenylmethoxymethyl)-3,3a,4,5,7,7a-hexahydro-1H-pyrano[3,4-c][1,2]oxazole.
| Compound Name | (3S,3aR,5R)-3-methyl-5-(phenylmethoxymethyl)-3,3a,4,5,7,7a-hexahydro-1H-pyrano[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 90011056 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (3S,3aR,5R)-3-methyl-5-(phenylmethoxymethyl)-3,3a,4,5,7,7a-hexahydro-1H-pyrano[3,4-c][1,2]oxazole |
| SMILES | C[C@@H]1ONC2CO[C@@H](COCc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C15H21NO3/c1-11-14-7-13(18-10-15(14)16-19-11)9-17-8-12-5-3-2-4-6-12/h2-6,11,13-16H,7-10H2,1H3/t11-,13+,14-,15?/m0/s1 |
| InChIKey | ORJANUZBPZRPSE-MFLQWKMISA-N |
| XLogP | 1.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |