C25H29N5O2 — CID 90012296
(3S)-N-[4-(1-pent-4-ynoylpiperidin-4-yl)phenyl]-N-pyridazin-3-ylpyrrolidine-3-carboxamide (PubChem CID 90012296) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (3S)-N-[4-(1-pent-4-ynoylpiperidin-4-yl)phenyl]-N-pyridazin-3-ylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[4-(1-pent-4-ynoylpiperidin-4-yl)phenyl]-N-pyridazin-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90012296 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (3S)-N-[4-(1-pent-4-ynoylpiperidin-4-yl)phenyl]-N-pyridazin-3-ylpyrrolidine-3-carboxamide |
| SMILES | C#CCCC(=O)N1CCC(c2ccc(N(C(=O)[C@H]3CCNC3)c3cccnn3)cc2)CC1 |
| InChI | InChI=1S/C25H29N5O2/c1-2-3-6-24(31)29-16-12-20(13-17-29)19-7-9-22(10-8-19)30(23-5-4-14-27-28-23)25(32)21-11-15-26-18-21/h1,4-5,7-10,14,20-21,26H,3,6,11-13,15-18H2/t21-/m0/s1 |
| InChIKey | PSILWZFTRPAUTQ-NRFANRHFSA-N |
| XLogP | 2.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|