C25H34N4O2 — CID 90013162
N-[4-[1-(2-methylbutyl)piperidin-4-yl]oxyphenyl]-N-pyridin-3-ylazetidine-3-carboxamide (PubChem CID 90013162) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[4-[1-(2-methylbutyl)piperidin-4-yl]oxyphenyl]-N-pyridin-3-ylazetidine-3-carboxamide.
| Compound Name | N-[4-[1-(2-methylbutyl)piperidin-4-yl]oxyphenyl]-N-pyridin-3-ylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 90013162 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | N-[4-[1-(2-methylbutyl)piperidin-4-yl]oxyphenyl]-N-pyridin-3-ylazetidine-3-carboxamide |
| SMILES | CCC(C)CN1CCC(Oc2ccc(N(C(=O)C3CNC3)c3cccnc3)cc2)CC1 |
| InChI | InChI=1S/C25H34N4O2/c1-3-19(2)18-28-13-10-24(11-14-28)31-23-8-6-21(7-9-23)29(22-5-4-12-26-17-22)25(30)20-15-27-16-20/h4-9,12,17,19-20,24,27H,3,10-11,13-16,18H2,1-2H3 |
| InChIKey | IPBBNBAIMWFOBE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |