C22H26F6N5O2PS — CID 90013425
9-[2-(1,1,1,5,5,5-hexafluoro-3-phosphanylpentan-3-yl)oxyethyl]-6-[4-(2-methylpropoxy)phenyl]sulfanylpurin-2-amine (PubChem CID 90013425) has the molecular formula C22H26F6N5O2PS and a molecular weight of 569.51 g/mol. Its IUPAC name is 9-[2-(1,1,1,5,5,5-hexafluoro-3-phosphanylpentan-3-yl)oxyethyl]-6-[4-(2-methylpropoxy)phenyl]sulfanylpurin-2-amine.
| Compound Name | 9-[2-(1,1,1,5,5,5-hexafluoro-3-phosphanylpentan-3-yl)oxyethyl]-6-[4-(2-methylpropoxy)phenyl]sulfanylpurin-2-amine |
|---|---|
| PubChem CID | 90013425 |
| Molecular Formula | C22H26F6N5O2PS |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 9-[2-(1,1,1,5,5,5-hexafluoro-3-phosphanylpentan-3-yl)oxyethyl]-6-[4-(2-methylpropoxy)phenyl]sulfanylpurin-2-amine |
| SMILES | CC(C)COc1ccc(Sc2nc(N)nc3c2ncn3CCOC(P)(CC(F)(F)F)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H26F6N5O2PS/c1-13(2)9-34-14-3-5-15(6-4-14)37-18-16-17(31-19(29)32-18)33(12-30-16)7-8-35-20(36,10-21(23,24)25)11-22(26,27)28/h3-6,12-13H,7-11,36H2,1-2H3,(H2,29,31,32) |
| InChIKey | XKWVGEZKYHCXKD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|