C19H16BrF6NO — CID 90013554
2-[4-[(6-bromo-3,4-dihydro-2H-quinolin-1-yl)methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 90013554) has the molecular formula C19H16BrF6NO and a molecular weight of 468.24 g/mol. Its IUPAC name is 2-[4-[(6-bromo-3,4-dihydro-2H-quinolin-1-yl)methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[(6-bromo-3,4-dihydro-2H-quinolin-1-yl)methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 90013554 |
| Molecular Formula | C19H16BrF6NO |
| Molecular Weight | 468.24 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2-[4-[(6-bromo-3,4-dihydro-2H-quinolin-1-yl)methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(CN2CCCc3cc(Br)ccc32)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H16BrF6NO/c20-15-7-8-16-13(10-15)2-1-9-27(16)11-12-3-5-14(6-4-12)17(28,18(21,22)23)19(24,25)26/h3-8,10,28H,1-2,9,11H2 |
| InChIKey | IRGSQOBWRDYOSG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.24 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |