About 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole
6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole (PubChem CID 90013773) has the molecular formula C34H30N4O
and a molecular weight of 510.64 g/mol. Its IUPAC name is 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole |
| PubChem CID | 90013773 |
| Molecular Formula | C34H30N4O |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole |
| SMILES | CN1CCN(c2ccc(-c3ccc4[nH]c5nccc(-c6ccc(Oc7ccccc7)cc6)c5c4c3)cc2)CC1 |
| InChI | InChI=1S/C34H30N4O/c1-37-19-21-38(22-20-37)27-12-7-24(8-13-27)26-11-16-32-31(23-26)33-30(17-18-35-34(33)36-32)25-9-14-29(15-10-25)39-28-5-3-2-4-6-28/h2-18,23H,19-22H2,1H3,(H,35,36) |
| InChIKey | MVVNKSOITCBCIN-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole?
The IUPAC name of 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole (CID 90013773) is 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole?
The canonical SMILES for 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole is CN1CCN(c2ccc(-c3ccc4[nH]c5nccc(-c6ccc(Oc7ccccc7)cc6)c5c4c3)cc2)CC1.
What is the InChIKey of 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole?
The InChIKey is MVVNKSOITCBCIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H30N4O/c1-37-19-21-38(22-20-37)27-12-7-24(8-13-27)26-11-16-32-31(23-26)33-30(17-18-35-34(33)36-32)25-9-14-29(15-10-25)39-28-5-3-2-4-6-28/h2-18,23H,19-22H2,1H3,(H,35,36).
What are the key properties of 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole?
6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole has a molecular weight of 510.64 g/mol, XLogP of 7.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4-phenoxyphenyl)-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 90013773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).