About 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine
5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine (PubChem CID 90014025) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine |
| PubChem CID | 90014025 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine |
| SMILES | Cc1ccc2nc(N)oc2n1 |
| InChI | InChI=1S/C7H7N3O/c1-4-2-3-5-6(9-4)11-7(8)10-5/h2-3H,1H3,(H2,8,10) |
| InChIKey | CZIYIIRPPADXHQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The IUPAC name of 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine (CID 90014025) is 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine.
What is the SMILES notation for 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The canonical SMILES for 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine is Cc1ccc2nc(N)oc2n1.
What is the InChIKey of 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The InChIKey is CZIYIIRPPADXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-4-2-3-5-6(9-4)11-7(8)10-5/h2-3H,1H3,(H2,8,10).
What are the key properties of 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine?
5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine has a molecular weight of 149.15 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine is sourced from PubChem (CID 90014025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).