C24H25N5O3S2 — CID 90014401
6-[[7-[4-(hydroxymethyl)piperidine-1-carbonyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one (PubChem CID 90014401) has the molecular formula C24H25N5O3S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 6-[[7-[4-(hydroxymethyl)piperidine-1-carbonyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[[7-[4-(hydroxymethyl)piperidine-1-carbonyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 90014401 |
| Molecular Formula | C24H25N5O3S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 6-[[7-[4-(hydroxymethyl)piperidine-1-carbonyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one |
| SMILES | O=C(C1CCc2c(sc3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c23)C1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C24H25N5O3S2/c30-11-13-5-7-29(8-6-13)23(31)14-1-3-16-18(9-14)33-22-20(16)21(25-12-26-22)27-15-2-4-17-19(10-15)34-24(32)28-17/h2,4,10,12-14,30H,1,3,5-9,11H2,(H,28,32)(H,25,26,27) |
| InChIKey | URZUCAWRENUEMQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |