C18H17N5OS2 — CID 90014477
6-[[7-(aminomethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one (PubChem CID 90014477) has the molecular formula C18H17N5OS2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 6-[[7-(aminomethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[[7-(aminomethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 90014477 |
| Molecular Formula | C18H17N5OS2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 6-[[7-(aminomethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]-3H-1,3-benzothiazol-2-one |
| SMILES | NCC1CCc2c(sc3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c23)C1 |
| InChI | InChI=1S/C18H17N5OS2/c19-7-9-1-3-11-13(5-9)25-17-15(11)16(20-8-21-17)22-10-2-4-12-14(6-10)26-18(24)23-12/h2,4,6,8-9H,1,3,5,7,19H2,(H,23,24)(H,20,21,22) |
| InChIKey | YTBUEPPLXHDKNK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |