C29H30N6O2S2 — CID 90014792
N-benzyl-N-[2-(dimethylamino)ethyl]-4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 90014792) has the molecular formula C29H30N6O2S2 and a molecular weight of 558.73 g/mol. Its IUPAC name is N-benzyl-N-[2-(dimethylamino)ethyl]-4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-benzyl-N-[2-(dimethylamino)ethyl]-4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 90014792 |
| Molecular Formula | C29H30N6O2S2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | N-benzyl-N-[2-(dimethylamino)ethyl]-4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C)CCN(Cc1ccccc1)C(=O)C1CCc2c(sc3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c23)C1 |
| InChI | InChI=1S/C29H30N6O2S2/c1-34(2)12-13-35(16-18-6-4-3-5-7-18)28(36)19-8-10-21-23(14-19)38-27-25(21)26(30-17-31-27)32-20-9-11-22-24(15-20)39-29(37)33-22/h3-7,9,11,15,17,19H,8,10,12-14,16H2,1-2H3,(H,33,37)(H,30,31,32) |
| InChIKey | IUEIPVSOAITKEY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |