C9H12F3NO4 — CID 90014884
4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoic acid (PubChem CID 90014884) has the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 90014884 |
| Molecular Formula | C9H12F3NO4 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoic acid |
| SMILES | C=CCOC(=O)NC(C(=O)O)C(C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO4/c1-3-4-17-8(16)13-6(7(14)15)5(2)9(10,11)12/h3,5-6H,1,4H2,2H3,(H,13,16)(H,14,15) |
| InChIKey | VRNXELRIHKWCGR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|