About [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate
[2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate (PubChem CID 90014931) has the molecular formula C29H40O4
and a molecular weight of 452.64 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate.
Molecular Properties
| Compound Name | [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate |
| PubChem CID | 90014931 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate |
| SMILES | CCOCC(CCCC=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H40O4/c1-8-32-20-22(16-12-13-17-30)24-18-23(28(2,3)4)19-25(29(5,6)7)26(24)33-27(31)21-14-10-9-11-15-21/h9-11,14-15,17-19,22H,8,12-13,16,20H2,1-7H3 |
| InChIKey | ISOMOYIJZSRZRW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate?
The IUPAC name of [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate (CID 90014931) is [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate.
What is the SMILES notation for [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate?
The canonical SMILES for [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate is CCOCC(CCCC=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OC(=O)c1ccccc1.
What is the InChIKey of [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate?
The InChIKey is ISOMOYIJZSRZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H40O4/c1-8-32-20-22(16-12-13-17-30)24-18-23(28(2,3)4)19-25(29(5,6)7)26(24)33-27(31)21-14-10-9-11-15-21/h9-11,14-15,17-19,22H,8,12-13,16,20H2,1-7H3.
What are the key properties of [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate?
[2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate has a molecular weight of 452.64 g/mol, XLogP of 6.99, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-ditert-butyl-6-(1-ethoxy-6-oxohexan-2-yl)phenyl] benzoate is sourced from PubChem (CID 90014931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).