C20H16F3N5O2S2 — CID 90014999
4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 90014999) has the molecular formula C20H16F3N5O2S2 and a molecular weight of 479.51 g/mol. Its IUPAC name is 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 90014999 |
| Molecular Formula | C20H16F3N5O2S2 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCc2c(sc3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c23)C1 |
| InChI | InChI=1S/C20H16F3N5O2S2/c21-20(22,23)7-24-17(29)9-1-3-11-13(5-9)31-18-15(11)16(25-8-26-18)27-10-2-4-12-14(6-10)32-19(30)28-12/h2,4,6,8-9H,1,3,5,7H2,(H,24,29)(H,28,30)(H,25,26,27) |
| InChIKey | LXUWPPRSJQCBFZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |