About 2-[(1R,2S)-2-fluorocyclopropyl]acetamide
2-[(1R,2S)-2-fluorocyclopropyl]acetamide (PubChem CID 90015212) has the molecular formula C5H8FNO
and a molecular weight of 117.12 g/mol. Its IUPAC name is 2-[(1R,2S)-2-fluorocyclopropyl]acetamide.
Molecular Properties
| Compound Name | 2-[(1R,2S)-2-fluorocyclopropyl]acetamide |
| PubChem CID | 90015212 |
| Molecular Formula | C5H8FNO |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 2-[(1R,2S)-2-fluorocyclopropyl]acetamide |
| SMILES | NC(=O)C[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C5H8FNO/c6-4-1-3(4)2-5(7)8/h3-4H,1-2H2,(H2,7,8)/t3-,4-/m0/s1 |
| InChIKey | JITDWIDXUHAUHY-IMJSIDKUSA-N |
| XLogP | 0.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(1R,2S)-2-fluorocyclopropyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2S)-2-fluorocyclopropyl]acetamide?
The IUPAC name of 2-[(1R,2S)-2-fluorocyclopropyl]acetamide (CID 90015212) is 2-[(1R,2S)-2-fluorocyclopropyl]acetamide.
What is the SMILES notation for 2-[(1R,2S)-2-fluorocyclopropyl]acetamide?
The canonical SMILES for 2-[(1R,2S)-2-fluorocyclopropyl]acetamide is NC(=O)C[C@@H]1C[C@@H]1F.
What is the InChIKey of 2-[(1R,2S)-2-fluorocyclopropyl]acetamide?
The InChIKey is JITDWIDXUHAUHY-IMJSIDKUSA-N. The full InChI is InChI=1S/C5H8FNO/c6-4-1-3(4)2-5(7)8/h3-4H,1-2H2,(H2,7,8)/t3-,4-/m0/s1.
What are the key properties of 2-[(1R,2S)-2-fluorocyclopropyl]acetamide?
2-[(1R,2S)-2-fluorocyclopropyl]acetamide has a molecular weight of 117.12 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S)-2-fluorocyclopropyl]acetamide is sourced from PubChem (CID 90015212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).