C18H15N5O3S — CID 90015276
4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxylic acid (PubChem CID 90015276) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxylic acid.
| Compound Name | 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 90015276 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxylic acid |
| SMILES | O=C(O)C1CCc2[nH]c3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c3c2C1 |
| InChI | InChI=1S/C18H15N5O3S/c24-17(25)8-1-3-11-10(5-8)14-15(19-7-20-16(14)22-11)21-9-2-4-12-13(6-9)27-18(26)23-12/h2,4,6-8H,1,3,5H2,(H,23,26)(H,24,25)(H2,19,20,21,22) |
| InChIKey | UISXJEYPSSOHAS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |